C24H35N3OS — CID 141217282
N-[(3-benzyl-2-butylimidazol-4-yl)methyl]-2-(cyclopentylmethyl)-3-sulfanylpropanamide (PubChem CID 141217282) has the molecular formula C24H35N3OS and a molecular weight of 413.63 g/mol. Its IUPAC name is N-[(3-benzyl-2-butylimidazol-4-yl)methyl]-2-(cyclopentylmethyl)-3-sulfanylpropanamide.
| Compound Name | N-[(3-benzyl-2-butylimidazol-4-yl)methyl]-2-(cyclopentylmethyl)-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 141217282 |
| Molecular Formula | C24H35N3OS |
| Molecular Weight | 413.63 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | N-[(3-benzyl-2-butylimidazol-4-yl)methyl]-2-(cyclopentylmethyl)-3-sulfanylpropanamide |
| SMILES | CCCCc1ncc(CNC(=O)C(CS)CC2CCCC2)n1Cc1ccccc1 |
| InChI | InChI=1S/C24H35N3OS/c1-2-3-13-23-25-15-22(27(23)17-20-11-5-4-6-12-20)16-26-24(28)21(18-29)14-19-9-7-8-10-19/h4-6,11-12,15,19,21,29H,2-3,7-10,13-14,16-18H2,1H3,(H,26,28) |
| InChIKey | PDXOAGZYZNAKOQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.63 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|