C23H33N3O3S — CID 87218950
4-[[2-butyl-5-[[[(2R)-4-methyl-2-(sulfanylmethyl)pentanoyl]amino]methyl]imidazol-1-yl]methyl]benzoic acid (PubChem CID 87218950) has the molecular formula C23H33N3O3S and a molecular weight of 431.60 g/mol. Its IUPAC name is 4-[[2-butyl-5-[[[(2R)-4-methyl-2-(sulfanylmethyl)pentanoyl]amino]methyl]imidazol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[2-butyl-5-[[[(2R)-4-methyl-2-(sulfanylmethyl)pentanoyl]amino]methyl]imidazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 87218950 |
| Molecular Formula | C23H33N3O3S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 4-[[2-butyl-5-[[[(2R)-4-methyl-2-(sulfanylmethyl)pentanoyl]amino]methyl]imidazol-1-yl]methyl]benzoic acid |
| SMILES | CCCCc1ncc(CNC(=O)[C@H](CS)CC(C)C)n1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H33N3O3S/c1-4-5-6-21-24-12-20(13-25-22(27)19(15-30)11-16(2)3)26(21)14-17-7-9-18(10-8-17)23(28)29/h7-10,12,16,19,30H,4-6,11,13-15H2,1-3H3,(H,25,27)(H,28,29)/t19-/m0/s1 |
| InChIKey | JGAUMNLIYQFILK-IBGZPJMESA-N |
| XLogP | 4.18 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|