C21H30FN3OS — CID 141217344
N-[[2-butyl-3-[(3-fluorophenyl)methyl]imidazol-4-yl]methyl]-4-methyl-2-sulfanylpentanamide (PubChem CID 141217344) has the molecular formula C21H30FN3OS and a molecular weight of 391.56 g/mol. Its IUPAC name is N-[[2-butyl-3-[(3-fluorophenyl)methyl]imidazol-4-yl]methyl]-4-methyl-2-sulfanylpentanamide.
| Compound Name | N-[[2-butyl-3-[(3-fluorophenyl)methyl]imidazol-4-yl]methyl]-4-methyl-2-sulfanylpentanamide |
|---|---|
| PubChem CID | 141217344 |
| Molecular Formula | C21H30FN3OS |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | N-[[2-butyl-3-[(3-fluorophenyl)methyl]imidazol-4-yl]methyl]-4-methyl-2-sulfanylpentanamide |
| SMILES | CCCCc1ncc(CNC(=O)C(S)CC(C)C)n1Cc1cccc(F)c1 |
| InChI | InChI=1S/C21H30FN3OS/c1-4-5-9-20-23-12-18(13-24-21(26)19(27)10-15(2)3)25(20)14-16-7-6-8-17(22)11-16/h6-8,11-12,15,19,27H,4-5,9-10,13-14H2,1-3H3,(H,24,26) |
| InChIKey | MWHNDJAIDCCZFK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|