C23H28N4OS — CID 141217309
2-benzyl-N-[(4-benzyl-5-propyl-1,2,4-triazol-3-yl)methyl]-3-sulfanylpropanamide (PubChem CID 141217309) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is 2-benzyl-N-[(4-benzyl-5-propyl-1,2,4-triazol-3-yl)methyl]-3-sulfanylpropanamide.
| Compound Name | 2-benzyl-N-[(4-benzyl-5-propyl-1,2,4-triazol-3-yl)methyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 141217309 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-benzyl-N-[(4-benzyl-5-propyl-1,2,4-triazol-3-yl)methyl]-3-sulfanylpropanamide |
| SMILES | CCCc1nnc(CNC(=O)C(CS)Cc2ccccc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C23H28N4OS/c1-2-9-21-25-26-22(27(21)16-19-12-7-4-8-13-19)15-24-23(28)20(17-29)14-18-10-5-3-6-11-18/h3-8,10-13,20,29H,2,9,14-17H2,1H3,(H,24,28) |
| InChIKey | NYODLHPTYCFQLL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|