C32H39N3OS — CID 141219080
N-[[7-methyl-3-[(4-phenylphenyl)methyl]-2-propylbenzimidazol-5-yl]methyl]-2-(sulfanylmethyl)hexanamide (PubChem CID 141219080) has the molecular formula C32H39N3OS and a molecular weight of 513.75 g/mol. Its IUPAC name is N-[[7-methyl-3-[(4-phenylphenyl)methyl]-2-propylbenzimidazol-5-yl]methyl]-2-(sulfanylmethyl)hexanamide.
| Compound Name | N-[[7-methyl-3-[(4-phenylphenyl)methyl]-2-propylbenzimidazol-5-yl]methyl]-2-(sulfanylmethyl)hexanamide |
|---|---|
| PubChem CID | 141219080 |
| Molecular Formula | C32H39N3OS |
| Molecular Weight | 513.75 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | N-[[7-methyl-3-[(4-phenylphenyl)methyl]-2-propylbenzimidazol-5-yl]methyl]-2-(sulfanylmethyl)hexanamide |
| SMILES | CCCCC(CS)C(=O)NCc1cc(C)c2nc(CCC)n(Cc3ccc(-c4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C32H39N3OS/c1-4-6-11-28(22-37)32(36)33-20-25-18-23(3)31-29(19-25)35(30(34-31)10-5-2)21-24-14-16-27(17-15-24)26-12-8-7-9-13-26/h7-9,12-19,28,37H,4-6,10-11,20-22H2,1-3H3,(H,33,36) |
| InChIKey | UDPIHJHVBFJAIH-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.75 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|