C32H35N7OS — CID 87382305
2-benzyl-N-[[2-butyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl]-3-sulfanylpropanamide (PubChem CID 87382305) has the molecular formula C32H35N7OS and a molecular weight of 565.75 g/mol. Its IUPAC name is 2-benzyl-N-[[2-butyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl]-3-sulfanylpropanamide.
| Compound Name | 2-benzyl-N-[[2-butyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 87382305 |
| Molecular Formula | C32H35N7OS |
| Molecular Weight | 565.75 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | 2-benzyl-N-[[2-butyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methyl]-3-sulfanylpropanamide |
| SMILES | CCCCc1nc(CNC(=O)C(CS)Cc2ccccc2)cn1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C32H35N7OS/c1-2-3-13-30-34-27(19-33-32(40)26(22-41)18-23-9-5-4-6-10-23)21-39(30)20-24-14-16-25(17-15-24)28-11-7-8-12-29(28)31-35-37-38-36-31/h4-12,14-17,21,26,41H,2-3,13,18-20,22H2,1H3,(H,33,40)(H,35,36,37,38) |
| InChIKey | DOGHBDXVEOPZPA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.75 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|