C29H32N6O2S — CID 87115442
2-benzyl-N-[2-oxo-2-[propyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]ethyl]-3-sulfanylpropanamide (PubChem CID 87115442) has the molecular formula C29H32N6O2S and a molecular weight of 528.68 g/mol. Its IUPAC name is 2-benzyl-N-[2-oxo-2-[propyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]ethyl]-3-sulfanylpropanamide.
| Compound Name | 2-benzyl-N-[2-oxo-2-[propyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]ethyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 87115442 |
| Molecular Formula | C29H32N6O2S |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 2-benzyl-N-[2-oxo-2-[propyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]ethyl]-3-sulfanylpropanamide |
| SMILES | CCCN(Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1)C(=O)CNC(=O)C(CS)Cc1ccccc1 |
| InChI | InChI=1S/C29H32N6O2S/c1-2-16-35(27(36)18-30-29(37)24(20-38)17-21-8-4-3-5-9-21)19-22-12-14-23(15-13-22)25-10-6-7-11-26(25)28-31-33-34-32-28/h3-15,24,38H,2,16-20H2,1H3,(H,30,37)(H,31,32,33,34) |
| InChIKey | OTBKQEAMSRVUBN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|