C23H30N6O — CID 68516464
1,3-dibutyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]urea (PubChem CID 68516464) has the molecular formula C23H30N6O and a molecular weight of 406.53 g/mol. Its IUPAC name is 1,3-dibutyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]urea.
| Compound Name | 1,3-dibutyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 68516464 |
| Molecular Formula | C23H30N6O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 1,3-dibutyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]urea |
| SMILES | CCCCNC(=O)N(CCCC)Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C23H30N6O/c1-3-5-15-24-23(30)29(16-6-4-2)17-18-11-13-19(14-12-18)20-9-7-8-10-21(20)22-25-27-28-26-22/h7-14H,3-6,15-17H2,1-2H3,(H,24,30)(H,25,26,27,28) |
| InChIKey | NETOFWKJBRGPAG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|