C23H27N7O3S — CID 139644262
2-[(2-amino-2-oxoethyl)-[butyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbamothioyl]amino]acetic acid (PubChem CID 139644262) has the molecular formula C23H27N7O3S and a molecular weight of 481.58 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[butyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbamothioyl]amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[butyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbamothioyl]amino]acetic acid |
|---|---|
| PubChem CID | 139644262 |
| Molecular Formula | C23H27N7O3S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[butyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbamothioyl]amino]acetic acid |
| SMILES | CCCCN(Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1)C(=S)N(CC(N)=O)CC(=O)O |
| InChI | InChI=1S/C23H27N7O3S/c1-2-3-12-29(23(34)30(14-20(24)31)15-21(32)33)13-16-8-10-17(11-9-16)18-6-4-5-7-19(18)22-25-27-28-26-22/h4-11H,2-3,12-15H2,1H3,(H2,24,31)(H,32,33)(H,25,26,27,28) |
| InChIKey | YDLYIYKSULORJV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 141.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|