C30H34N6O3S — CID 139633021
methyl 2-[[butyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbamothioyl]amino]-3-(4-methoxyphenyl)propanoate (PubChem CID 139633021) has the molecular formula C30H34N6O3S and a molecular weight of 558.71 g/mol. Its IUPAC name is methyl 2-[[butyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbamothioyl]amino]-3-(4-methoxyphenyl)propanoate.
| Compound Name | methyl 2-[[butyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbamothioyl]amino]-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 139633021 |
| Molecular Formula | C30H34N6O3S |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | methyl 2-[[butyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbamothioyl]amino]-3-(4-methoxyphenyl)propanoate |
| SMILES | CCCCN(Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1)C(=S)NC(Cc1ccc(OC)cc1)C(=O)OC |
| InChI | InChI=1S/C30H34N6O3S/c1-4-5-18-36(30(40)31-27(29(37)39-3)19-21-12-16-24(38-2)17-13-21)20-22-10-14-23(15-11-22)25-8-6-7-9-26(25)28-32-34-35-33-28/h6-17,27H,4-5,18-20H2,1-3H3,(H,31,40)(H,32,33,34,35) |
| InChIKey | PNOKCXJLTKVPDE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|