C28H38N6O3S — CID 91574932
butyl N-[2-[[4-methyl-2-(sulfanylmethyl)pentanoyl]amino]ethyl]-N-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbamate (PubChem CID 91574932) has the molecular formula C28H38N6O3S and a molecular weight of 538.72 g/mol. Its IUPAC name is butyl N-[2-[[4-methyl-2-(sulfanylmethyl)pentanoyl]amino]ethyl]-N-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbamate.
| Compound Name | butyl N-[2-[[4-methyl-2-(sulfanylmethyl)pentanoyl]amino]ethyl]-N-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 91574932 |
| Molecular Formula | C28H38N6O3S |
| Molecular Weight | 538.72 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | butyl N-[2-[[4-methyl-2-(sulfanylmethyl)pentanoyl]amino]ethyl]-N-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]carbamate |
| SMILES | CCCCOC(=O)N(CCNC(=O)C(CS)CC(C)C)Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C28H38N6O3S/c1-4-5-16-37-28(36)34(15-14-29-27(35)23(19-38)17-20(2)3)18-21-10-12-22(13-11-21)24-8-6-7-9-25(24)26-30-32-33-31-26/h6-13,20,23,38H,4-5,14-19H2,1-3H3,(H,29,35)(H,30,31,32,33) |
| InChIKey | RUORCQSKJKQKGQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.72 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|