C30H43N7O2S — CID 87165909
N-[2-[hexylcarbamoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]ethyl]-4-methyl-2-(sulfanylmethyl)pentanamide (PubChem CID 87165909) has the molecular formula C30H43N7O2S and a molecular weight of 565.79 g/mol. Its IUPAC name is N-[2-[hexylcarbamoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]ethyl]-4-methyl-2-(sulfanylmethyl)pentanamide.
| Compound Name | N-[2-[hexylcarbamoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]ethyl]-4-methyl-2-(sulfanylmethyl)pentanamide |
|---|---|
| PubChem CID | 87165909 |
| Molecular Formula | C30H43N7O2S |
| Molecular Weight | 565.79 g/mol |
| Exact Mass | 565.32 |
| IUPAC Name | N-[2-[hexylcarbamoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]ethyl]-4-methyl-2-(sulfanylmethyl)pentanamide |
| SMILES | CCCCCCNC(=O)N(CCNC(=O)C(CS)CC(C)C)Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C30H43N7O2S/c1-4-5-6-9-16-32-30(39)37(18-17-31-29(38)25(21-40)19-22(2)3)20-23-12-14-24(15-13-23)26-10-7-8-11-27(26)28-33-35-36-34-28/h7-8,10-15,22,25,40H,4-6,9,16-21H2,1-3H3,(H,31,38)(H,32,39)(H,33,34,35,36) |
| InChIKey | MIXZZHXKVNYQIJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.79 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|