C31H41N7O6 — CID 25224450
methyl 3-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]-4-oxo-4-[pentyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoate (PubChem CID 25224450) has the molecular formula C31H41N7O6 and a molecular weight of 607.71 g/mol. Its IUPAC name is methyl 3-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]-4-oxo-4-[pentyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoate.
| Compound Name | methyl 3-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]-4-oxo-4-[pentyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoate |
|---|---|
| PubChem CID | 25224450 |
| Molecular Formula | C31H41N7O6 |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.31 |
| IUPAC Name | methyl 3-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]-4-oxo-4-[pentyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoate |
| SMILES | CCCCCN(Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1)C(=O)C(CC(=O)OC)NC(=O)C(CC(C)C)C(=O)NO |
| InChI | InChI=1S/C31H41N7O6/c1-5-6-9-16-38(31(42)26(18-27(39)44-4)32-29(40)25(17-20(2)3)30(41)35-43)19-21-12-14-22(15-13-21)23-10-7-8-11-24(23)28-33-36-37-34-28/h7-8,10-15,20,25-26,43H,5-6,9,16-19H2,1-4H3,(H,32,40)(H,35,41)(H,33,34,36,37) |
| InChIKey | WKXVPTPJFRVWFB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 179.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|