C25H32N6O2S — CID 91257594
N-[2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]ethyl]-N-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pentanamide (PubChem CID 91257594) has the molecular formula C25H32N6O2S and a molecular weight of 480.64 g/mol. Its IUPAC name is N-[2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]ethyl]-N-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pentanamide.
| Compound Name | N-[2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]ethyl]-N-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 91257594 |
| Molecular Formula | C25H32N6O2S |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | N-[2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]ethyl]-N-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pentanamide |
| SMILES | CCCCC(=O)N(CCNC(=O)[C@H](C)CS)Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C25H32N6O2S/c1-3-4-9-23(32)31(15-14-26-25(33)18(2)17-34)16-19-10-12-20(13-11-19)21-7-5-6-8-22(21)24-27-29-30-28-24/h5-8,10-13,18,34H,3-4,9,14-17H2,1-2H3,(H,26,33)(H,27,28,29,30)/t18-/m1/s1 |
| InChIKey | OZRUJGQZRXTXBE-GOSISDBHSA-N |
| XLogP | 3.73 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|