C27H35N5O3 — CID 163777662
methyl 2-[(2-butyloxiran-2-yl)-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]-4-methylpentanoate (PubChem CID 163777662) has the molecular formula C27H35N5O3 and a molecular weight of 477.61 g/mol. Its IUPAC name is methyl 2-[(2-butyloxiran-2-yl)-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]-4-methylpentanoate.
| Compound Name | methyl 2-[(2-butyloxiran-2-yl)-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 163777662 |
| Molecular Formula | C27H35N5O3 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | methyl 2-[(2-butyloxiran-2-yl)-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]-4-methylpentanoate |
| SMILES | CCCCC1(N(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)C(CC(C)C)C(=O)OC)CO1 |
| InChI | InChI=1S/C27H35N5O3/c1-5-6-15-27(18-35-27)32(24(16-19(2)3)26(33)34-4)17-20-11-13-21(14-12-20)22-9-7-8-10-23(22)25-28-30-31-29-25/h7-14,19,24H,5-6,15-18H2,1-4H3,(H,28,29,30,31) |
| InChIKey | MLWKAIRXORHVCQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|