C22H26N6O3 — CID 173109349
5-[3-hydroxypropanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]pentanamide (PubChem CID 173109349) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is 5-[3-hydroxypropanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]pentanamide.
| Compound Name | 5-[3-hydroxypropanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]pentanamide |
|---|---|
| PubChem CID | 173109349 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 5-[3-hydroxypropanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]pentanamide |
| SMILES | NC(=O)CCCCN(Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1)C(=O)CCO |
| InChI | InChI=1S/C22H26N6O3/c23-20(30)7-3-4-13-28(21(31)12-14-29)15-16-8-10-17(11-9-16)18-5-1-2-6-19(18)22-24-26-27-25-22/h1-2,5-6,8-11,29H,3-4,7,12-15H2,(H2,23,30)(H,24,25,26,27) |
| InChIKey | YTQHYHJCHAWJGP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 138.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|