C28H29F3N6O — CID 19024464
1-methyl-3-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1-[2-(trifluoromethyl)phenyl]urea (PubChem CID 19024464) has the molecular formula C28H29F3N6O and a molecular weight of 522.58 g/mol. Its IUPAC name is 1-methyl-3-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-methyl-3-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 19024464 |
| Molecular Formula | C28H29F3N6O |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | 1-methyl-3-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1-[2-(trifluoromethyl)phenyl]urea |
| SMILES | CCCCCN(Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1)C(=O)N(C)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C28H29F3N6O/c1-3-4-9-18-37(27(38)36(2)25-13-8-7-12-24(25)28(29,30)31)19-20-14-16-21(17-15-20)22-10-5-6-11-23(22)26-32-34-35-33-26/h5-8,10-17H,3-4,9,18-19H2,1-2H3,(H,32,33,34,35) |
| InChIKey | BMNVZBRCDYWYNQ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|