C25H28N4O2 — CID 67794928
2-[[2-butyl-3-[(2-cyanophenyl)methyl]imidazol-4-yl]methylamino]-3-phenylpropanoic acid (PubChem CID 67794928) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 2-[[2-butyl-3-[(2-cyanophenyl)methyl]imidazol-4-yl]methylamino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-butyl-3-[(2-cyanophenyl)methyl]imidazol-4-yl]methylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 67794928 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 2-[[2-butyl-3-[(2-cyanophenyl)methyl]imidazol-4-yl]methylamino]-3-phenylpropanoic acid |
| SMILES | CCCCc1ncc(CNC(Cc2ccccc2)C(=O)O)n1Cc1ccccc1C#N |
| InChI | InChI=1S/C25H28N4O2/c1-2-3-13-24-28-17-22(29(24)18-21-12-8-7-11-20(21)15-26)16-27-23(25(30)31)14-19-9-5-4-6-10-19/h4-12,17,23,27H,2-3,13-14,16,18H2,1H3,(H,30,31) |
| InChIKey | GINPKOMLDZMKMT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |