C20H27ClN2O2 — CID 10642438
tert-butyl 4-[[2-butyl-5-(chloromethyl)imidazol-1-yl]methyl]benzoate (PubChem CID 10642438) has the molecular formula C20H27ClN2O2 and a molecular weight of 362.90 g/mol. Its IUPAC name is tert-butyl 4-[[2-butyl-5-(chloromethyl)imidazol-1-yl]methyl]benzoate.
| Compound Name | tert-butyl 4-[[2-butyl-5-(chloromethyl)imidazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 10642438 |
| Molecular Formula | C20H27ClN2O2 |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | tert-butyl 4-[[2-butyl-5-(chloromethyl)imidazol-1-yl]methyl]benzoate |
| SMILES | CCCCc1ncc(CCl)n1Cc1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H27ClN2O2/c1-5-6-7-18-22-13-17(12-21)23(18)14-15-8-10-16(11-9-15)19(24)25-20(2,3)4/h8-11,13H,5-7,12,14H2,1-4H3 |
| InChIKey | QEWZNCGIVPHNMO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|