C33H34N2O2 — CID 142629693
tert-butyl 4-[4-[(2-butylbenzimidazol-1-yl)methyl]phenyl]naphthalene-2-carboxylate (PubChem CID 142629693) has the molecular formula C33H34N2O2 and a molecular weight of 490.65 g/mol. Its IUPAC name is tert-butyl 4-[4-[(2-butylbenzimidazol-1-yl)methyl]phenyl]naphthalene-2-carboxylate.
| Compound Name | tert-butyl 4-[4-[(2-butylbenzimidazol-1-yl)methyl]phenyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 142629693 |
| Molecular Formula | C33H34N2O2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | tert-butyl 4-[4-[(2-butylbenzimidazol-1-yl)methyl]phenyl]naphthalene-2-carboxylate |
| SMILES | CCCCc1nc2ccccc2n1Cc1ccc(-c2cc(C(=O)OC(C)(C)C)cc3ccccc23)cc1 |
| InChI | InChI=1S/C33H34N2O2/c1-5-6-15-31-34-29-13-9-10-14-30(29)35(31)22-23-16-18-24(19-17-23)28-21-26(32(36)37-33(2,3)4)20-25-11-7-8-12-27(25)28/h7-14,16-21H,5-6,15,22H2,1-4H3 |
| InChIKey | HOVFSESXFJSJIW-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |