C25H37ClN2O3Si — CID 86747096
methyl (E)-3-[2-butyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(2-chlorophenyl)methyl]imidazol-4-yl]prop-2-enoate (PubChem CID 86747096) has the molecular formula C25H37ClN2O3Si and a molecular weight of 477.12 g/mol. Its IUPAC name is methyl (E)-3-[2-butyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(2-chlorophenyl)methyl]imidazol-4-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-butyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(2-chlorophenyl)methyl]imidazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 86747096 |
| Molecular Formula | C25H37ClN2O3Si |
| Molecular Weight | 477.12 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | methyl (E)-3-[2-butyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(2-chlorophenyl)methyl]imidazol-4-yl]prop-2-enoate |
| SMILES | CCCCc1nc(CO[Si](C)(C)C(C)(C)C)c(/C=C/C(=O)OC)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C25H37ClN2O3Si/c1-8-9-14-23-27-21(18-31-32(6,7)25(2,3)4)22(15-16-24(29)30-5)28(23)17-19-12-10-11-13-20(19)26/h10-13,15-16H,8-9,14,17-18H2,1-7H3/b16-15+ |
| InChIKey | GQNHGHYKEVMAHK-FOCLMDBBSA-N |
| XLogP | 6.64 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.12 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|