C25H31Cl2N3O6 — CID 90958428
methyl 3-[3-[[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-chlorophenyl]methyl]-5-chloro-2-methylimidazol-4-yl]prop-2-enoate (PubChem CID 90958428) has the molecular formula C25H31Cl2N3O6 and a molecular weight of 540.44 g/mol. Its IUPAC name is methyl 3-[3-[[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-chlorophenyl]methyl]-5-chloro-2-methylimidazol-4-yl]prop-2-enoate.
| Compound Name | methyl 3-[3-[[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-chlorophenyl]methyl]-5-chloro-2-methylimidazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 90958428 |
| Molecular Formula | C25H31Cl2N3O6 |
| Molecular Weight | 540.44 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | methyl 3-[3-[[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-chlorophenyl]methyl]-5-chloro-2-methylimidazol-4-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1c(Cl)nc(C)n1Cc1ccc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1Cl |
| InChI | InChI=1S/C25H31Cl2N3O6/c1-15-28-21(27)19(11-12-20(31)34-8)29(15)14-16-9-10-17(13-18(16)26)30(22(32)35-24(2,3)4)23(33)36-25(5,6)7/h9-13H,14H2,1-8H3 |
| InChIKey | VXPPRTPOBOZFOE-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.44 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|