C15H13BrCl2N2O2 — CID 90753546
methyl 3-[3-[(4-bromo-2-chlorophenyl)methyl]-5-chloro-2-methylimidazol-4-yl]prop-2-enoate (PubChem CID 90753546) has the molecular formula C15H13BrCl2N2O2 and a molecular weight of 404.09 g/mol. Its IUPAC name is methyl 3-[3-[(4-bromo-2-chlorophenyl)methyl]-5-chloro-2-methylimidazol-4-yl]prop-2-enoate.
| Compound Name | methyl 3-[3-[(4-bromo-2-chlorophenyl)methyl]-5-chloro-2-methylimidazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 90753546 |
| Molecular Formula | C15H13BrCl2N2O2 |
| Molecular Weight | 404.09 g/mol |
| Exact Mass | 401.95 |
| IUPAC Name | methyl 3-[3-[(4-bromo-2-chlorophenyl)methyl]-5-chloro-2-methylimidazol-4-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1c(Cl)nc(C)n1Cc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H13BrCl2N2O2/c1-9-19-15(18)13(5-6-14(21)22-2)20(9)8-10-3-4-11(16)7-12(10)17/h3-7H,8H2,1-2H3 |
| InChIKey | NMSSDZVBEWOZBO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.09 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|