C16H15Cl2IN2O2 — CID 90859698
methyl 3-[5-chloro-3-[(2-chloro-4-iodophenyl)methyl]-2-ethylimidazol-4-yl]prop-2-enoate (PubChem CID 90859698) has the molecular formula C16H15Cl2IN2O2 and a molecular weight of 465.12 g/mol. Its IUPAC name is methyl 3-[5-chloro-3-[(2-chloro-4-iodophenyl)methyl]-2-ethylimidazol-4-yl]prop-2-enoate.
| Compound Name | methyl 3-[5-chloro-3-[(2-chloro-4-iodophenyl)methyl]-2-ethylimidazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 90859698 |
| Molecular Formula | C16H15Cl2IN2O2 |
| Molecular Weight | 465.12 g/mol |
| Exact Mass | 463.96 |
| IUPAC Name | methyl 3-[5-chloro-3-[(2-chloro-4-iodophenyl)methyl]-2-ethylimidazol-4-yl]prop-2-enoate |
| SMILES | CCc1nc(Cl)c(C=CC(=O)OC)n1Cc1ccc(I)cc1Cl |
| InChI | InChI=1S/C16H15Cl2IN2O2/c1-3-14-20-16(18)13(6-7-15(22)23-2)21(14)9-10-4-5-11(19)8-12(10)17/h4-8H,3,9H2,1-2H3 |
| InChIKey | PFGGZLXBPKLWKC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.12 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|