C24H20Cl2N2O2 — CID 91486520
methyl 3-[5-chloro-3-[[2-chloro-4-(2-phenylethynyl)phenyl]methyl]-2-ethylimidazol-4-yl]prop-2-enoate (PubChem CID 91486520) has the molecular formula C24H20Cl2N2O2 and a molecular weight of 439.34 g/mol. Its IUPAC name is methyl 3-[5-chloro-3-[[2-chloro-4-(2-phenylethynyl)phenyl]methyl]-2-ethylimidazol-4-yl]prop-2-enoate.
| Compound Name | methyl 3-[5-chloro-3-[[2-chloro-4-(2-phenylethynyl)phenyl]methyl]-2-ethylimidazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 91486520 |
| Molecular Formula | C24H20Cl2N2O2 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | methyl 3-[5-chloro-3-[[2-chloro-4-(2-phenylethynyl)phenyl]methyl]-2-ethylimidazol-4-yl]prop-2-enoate |
| SMILES | CCc1nc(Cl)c(C=CC(=O)OC)n1Cc1ccc(C#Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C24H20Cl2N2O2/c1-3-22-27-24(26)21(13-14-23(29)30-2)28(22)16-19-12-11-18(15-20(19)25)10-9-17-7-5-4-6-8-17/h4-8,11-15H,3,16H2,1-2H3 |
| InChIKey | MUYZEKILCJEZLN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|