C22H28Cl2N2O3 — CID 148546275
ethyl (E)-3-[5-chloro-3-[(2-chloro-4-pentoxyphenyl)methyl]-2-methylimidazol-4-yl]-2-methylprop-2-enoate (PubChem CID 148546275) has the molecular formula C22H28Cl2N2O3 and a molecular weight of 439.38 g/mol. Its IUPAC name is ethyl (E)-3-[5-chloro-3-[(2-chloro-4-pentoxyphenyl)methyl]-2-methylimidazol-4-yl]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[5-chloro-3-[(2-chloro-4-pentoxyphenyl)methyl]-2-methylimidazol-4-yl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 148546275 |
| Molecular Formula | C22H28Cl2N2O3 |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | ethyl (E)-3-[5-chloro-3-[(2-chloro-4-pentoxyphenyl)methyl]-2-methylimidazol-4-yl]-2-methylprop-2-enoate |
| SMILES | CCCCCOc1ccc(Cn2c(C)nc(Cl)c2/C=C(\C)C(=O)OCC)c(Cl)c1 |
| InChI | InChI=1S/C22H28Cl2N2O3/c1-5-7-8-11-29-18-10-9-17(19(23)13-18)14-26-16(4)25-21(24)20(26)12-15(3)22(27)28-6-2/h9-10,12-13H,5-8,11,14H2,1-4H3/b15-12+ |
| InChIKey | RQJDHTQOVOIVPL-NTCAYCPXSA-N |
| XLogP | 6.08 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|