C24H31ClN4O4S — CID 22508677
3-[(2-chloro-4-pentoxyphenyl)methyl]-2-methyl-N-(propylsulfamoyl)benzimidazole-5-carboxamide (PubChem CID 22508677) has the molecular formula C24H31ClN4O4S and a molecular weight of 507.06 g/mol. Its IUPAC name is 3-[(2-chloro-4-pentoxyphenyl)methyl]-2-methyl-N-(propylsulfamoyl)benzimidazole-5-carboxamide.
| Compound Name | 3-[(2-chloro-4-pentoxyphenyl)methyl]-2-methyl-N-(propylsulfamoyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 22508677 |
| Molecular Formula | C24H31ClN4O4S |
| Molecular Weight | 507.06 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 3-[(2-chloro-4-pentoxyphenyl)methyl]-2-methyl-N-(propylsulfamoyl)benzimidazole-5-carboxamide |
| SMILES | CCCCCOc1ccc(Cn2c(C)nc3ccc(C(=O)NS(=O)(=O)NCCC)cc32)c(Cl)c1 |
| InChI | InChI=1S/C24H31ClN4O4S/c1-4-6-7-13-33-20-10-8-19(21(25)15-20)16-29-17(3)27-22-11-9-18(14-23(22)29)24(30)28-34(31,32)26-12-5-2/h8-11,14-15,26H,4-7,12-13,16H2,1-3H3,(H,28,30) |
| InChIKey | OJCOFYLKEBOCBK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.06 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|