C20H22Cl2N4O3S — CID 18467562
N-(butylsulfamoyl)-3-[(2,4-dichlorophenyl)methyl]-2-methylbenzimidazole-5-carboxamide (PubChem CID 18467562) has the molecular formula C20H22Cl2N4O3S and a molecular weight of 469.39 g/mol. Its IUPAC name is N-(butylsulfamoyl)-3-[(2,4-dichlorophenyl)methyl]-2-methylbenzimidazole-5-carboxamide.
| Compound Name | N-(butylsulfamoyl)-3-[(2,4-dichlorophenyl)methyl]-2-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 18467562 |
| Molecular Formula | C20H22Cl2N4O3S |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | N-(butylsulfamoyl)-3-[(2,4-dichlorophenyl)methyl]-2-methylbenzimidazole-5-carboxamide |
| SMILES | CCCCNS(=O)(=O)NC(=O)c1ccc2nc(C)n(Cc3ccc(Cl)cc3Cl)c2c1 |
| InChI | InChI=1S/C20H22Cl2N4O3S/c1-3-4-9-23-30(28,29)25-20(27)14-6-8-18-19(10-14)26(13(2)24-18)12-15-5-7-16(21)11-17(15)22/h5-8,10-11,23H,3-4,9,12H2,1-2H3,(H,25,27) |
| InChIKey | UNZJRNYMDUCLEQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|