C16H13Cl2N3O — CID 18681118
3-[(2,4-dichlorophenyl)methyl]-2-methylbenzimidazole-5-carboxamide (PubChem CID 18681118) has the molecular formula C16H13Cl2N3O and a molecular weight of 334.21 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methyl]-2-methylbenzimidazole-5-carboxamide.
| Compound Name | 3-[(2,4-dichlorophenyl)methyl]-2-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 18681118 |
| Molecular Formula | C16H13Cl2N3O |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methyl]-2-methylbenzimidazole-5-carboxamide |
| SMILES | Cc1nc2ccc(C(N)=O)cc2n1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl2N3O/c1-9-20-14-5-3-10(16(19)22)6-15(14)21(9)8-11-2-4-12(17)7-13(11)18/h2-7H,8H2,1H3,(H2,19,22) |
| InChIKey | HYWHIQPGBQHILG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |