C27H31ClN4O3S — CID 174361161
3-[(2-chloro-4-phenylphenyl)methyl]-2-methylbenzimidazole-5-carboxamide;pentane-1-sulfonamide (PubChem CID 174361161) has the molecular formula C27H31ClN4O3S and a molecular weight of 527.09 g/mol. Its IUPAC name is 3-[(2-chloro-4-phenylphenyl)methyl]-2-methylbenzimidazole-5-carboxamide;pentane-1-sulfonamide.
| Compound Name | 3-[(2-chloro-4-phenylphenyl)methyl]-2-methylbenzimidazole-5-carboxamide;pentane-1-sulfonamide |
|---|---|
| PubChem CID | 174361161 |
| Molecular Formula | C27H31ClN4O3S |
| Molecular Weight | 527.09 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 3-[(2-chloro-4-phenylphenyl)methyl]-2-methylbenzimidazole-5-carboxamide;pentane-1-sulfonamide |
| SMILES | CCCCCS(N)(=O)=O.Cc1nc2ccc(C(N)=O)cc2n1Cc1ccc(-c2ccccc2)cc1Cl |
| InChI | InChI=1S/C22H18ClN3O.C5H13NO2S/c1-14-25-20-10-9-17(22(24)27)12-21(20)26(14)13-18-8-7-16(11-19(18)23)15-5-3-2-4-6-15;1-2-3-4-5-9(6,7)8/h2-12H,13H2,1H3,(H2,24,27);2-5H2,1H3,(H2,6,7,8) |
| InChIKey | FYWBNIQWSDMAQE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 121.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.09 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|