C24H30ClN3O2 — CID 22508782
ethyl 3-[[2-chloro-4-[methyl(pentyl)amino]phenyl]methyl]-2-methylbenzimidazole-5-carboxylate (PubChem CID 22508782) has the molecular formula C24H30ClN3O2 and a molecular weight of 427.98 g/mol. Its IUPAC name is ethyl 3-[[2-chloro-4-[methyl(pentyl)amino]phenyl]methyl]-2-methylbenzimidazole-5-carboxylate.
| Compound Name | ethyl 3-[[2-chloro-4-[methyl(pentyl)amino]phenyl]methyl]-2-methylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 22508782 |
| Molecular Formula | C24H30ClN3O2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | ethyl 3-[[2-chloro-4-[methyl(pentyl)amino]phenyl]methyl]-2-methylbenzimidazole-5-carboxylate |
| SMILES | CCCCCN(C)c1ccc(Cn2c(C)nc3ccc(C(=O)OCC)cc32)c(Cl)c1 |
| InChI | InChI=1S/C24H30ClN3O2/c1-5-7-8-13-27(4)20-11-9-19(21(25)15-20)16-28-17(3)26-22-12-10-18(14-23(22)28)24(29)30-6-2/h9-12,14-15H,5-8,13,16H2,1-4H3 |
| InChIKey | XUDAGHKYCUJGKB-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|