C24H20Cl2N2O2 — CID 18315443
ethyl 2-benzyl-3-[(2,4-dichlorophenyl)methyl]benzimidazole-5-carboxylate (PubChem CID 18315443) has the molecular formula C24H20Cl2N2O2 and a molecular weight of 439.34 g/mol. Its IUPAC name is ethyl 2-benzyl-3-[(2,4-dichlorophenyl)methyl]benzimidazole-5-carboxylate.
| Compound Name | ethyl 2-benzyl-3-[(2,4-dichlorophenyl)methyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 18315443 |
| Molecular Formula | C24H20Cl2N2O2 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | ethyl 2-benzyl-3-[(2,4-dichlorophenyl)methyl]benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(Cc3ccccc3)n(Cc3ccc(Cl)cc3Cl)c2c1 |
| InChI | InChI=1S/C24H20Cl2N2O2/c1-2-30-24(29)17-9-11-21-22(13-17)28(15-18-8-10-19(25)14-20(18)26)23(27-21)12-16-6-4-3-5-7-16/h3-11,13-14H,2,12,15H2,1H3 |
| InChIKey | OOZOIDRCRZBELT-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |