C25H26ClN3O4S — CID 18467577
3-[[2-chloro-4-(furan-2-yl)phenyl]methyl]-2-methyl-N-pentylsulfonylbenzimidazole-5-carboxamide (PubChem CID 18467577) has the molecular formula C25H26ClN3O4S and a molecular weight of 500.02 g/mol. Its IUPAC name is 3-[[2-chloro-4-(furan-2-yl)phenyl]methyl]-2-methyl-N-pentylsulfonylbenzimidazole-5-carboxamide.
| Compound Name | 3-[[2-chloro-4-(furan-2-yl)phenyl]methyl]-2-methyl-N-pentylsulfonylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 18467577 |
| Molecular Formula | C25H26ClN3O4S |
| Molecular Weight | 500.02 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 3-[[2-chloro-4-(furan-2-yl)phenyl]methyl]-2-methyl-N-pentylsulfonylbenzimidazole-5-carboxamide |
| SMILES | CCCCCS(=O)(=O)NC(=O)c1ccc2nc(C)n(Cc3ccc(-c4ccco4)cc3Cl)c2c1 |
| InChI | InChI=1S/C25H26ClN3O4S/c1-3-4-5-13-34(31,32)28-25(30)19-10-11-22-23(15-19)29(17(2)27-22)16-20-9-8-18(14-21(20)26)24-7-6-12-33-24/h6-12,14-15H,3-5,13,16H2,1-2H3,(H,28,30) |
| InChIKey | QOSLFJZFUCYPIU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.02 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|