C22H28ClN3O3SSi — CID 18680934
3-[(2-chlorophenyl)methyl]-2-methyl-N-(3-trimethylsilylpropylsulfonyl)benzimidazole-5-carboxamide (PubChem CID 18680934) has the molecular formula C22H28ClN3O3SSi and a molecular weight of 478.09 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-2-methyl-N-(3-trimethylsilylpropylsulfonyl)benzimidazole-5-carboxamide.
| Compound Name | 3-[(2-chlorophenyl)methyl]-2-methyl-N-(3-trimethylsilylpropylsulfonyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 18680934 |
| Molecular Formula | C22H28ClN3O3SSi |
| Molecular Weight | 478.09 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-2-methyl-N-(3-trimethylsilylpropylsulfonyl)benzimidazole-5-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)NS(=O)(=O)CCC[Si](C)(C)C)cc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C22H28ClN3O3SSi/c1-16-24-20-11-10-17(22(27)25-30(28,29)12-7-13-31(2,3)4)14-21(20)26(16)15-18-8-5-6-9-19(18)23/h5-6,8-11,14H,7,12-13,15H2,1-4H3,(H,25,27) |
| InChIKey | DVFAZZSJZXADNZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.09 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|