C25H19ClN4O3S — CID 18315545
3-[(2-chlorophenyl)methyl]-2-methyl-N-quinolin-8-ylsulfonylbenzimidazole-5-carboxamide (PubChem CID 18315545) has the molecular formula C25H19ClN4O3S and a molecular weight of 490.97 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-2-methyl-N-quinolin-8-ylsulfonylbenzimidazole-5-carboxamide.
| Compound Name | 3-[(2-chlorophenyl)methyl]-2-methyl-N-quinolin-8-ylsulfonylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 18315545 |
| Molecular Formula | C25H19ClN4O3S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-2-methyl-N-quinolin-8-ylsulfonylbenzimidazole-5-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)NS(=O)(=O)c3cccc4cccnc34)cc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C25H19ClN4O3S/c1-16-28-21-12-11-18(14-22(21)30(16)15-19-6-2-3-9-20(19)26)25(31)29-34(32,33)23-10-4-7-17-8-5-13-27-24(17)23/h2-14H,15H2,1H3,(H,29,31) |
| InChIKey | WHIBSASJRUABIG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |