C22H18KN4O5S+ — CID 23717741
potassium N-(benzenesulfonyl)-2-methyl-3-[(4-nitrophenyl)methyl]benzimidazole-5-carboxamide (PubChem CID 23717741) has the molecular formula C22H18KN4O5S+ and a molecular weight of 489.57 g/mol. Its IUPAC name is potassium N-(benzenesulfonyl)-2-methyl-3-[(4-nitrophenyl)methyl]benzimidazole-5-carboxamide.
| Compound Name | potassium N-(benzenesulfonyl)-2-methyl-3-[(4-nitrophenyl)methyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 23717741 |
| Molecular Formula | C22H18KN4O5S+ |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | potassium N-(benzenesulfonyl)-2-methyl-3-[(4-nitrophenyl)methyl]benzimidazole-5-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)NS(=O)(=O)c3ccccc3)cc2n1Cc1ccc([N+](=O)[O-])cc1.[K+] |
| InChI | InChI=1S/C22H18N4O5S.K/c1-15-23-20-12-9-17(22(27)24-32(30,31)19-5-3-2-4-6-19)13-21(20)25(15)14-16-7-10-18(11-8-16)26(28)29;/h2-13H,14H2,1H3,(H,24,27);/q;+1 |
| InChIKey | TXGCOUBZEMOBRN-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|