C22H19KN4O5S — CID 173201492
potassium;N-(benzenesulfonyl)-2-methyl-3-[(4-nitrophenyl)methyl]benzimidazole-5-carboxamide;hydride (PubChem CID 173201492) has the molecular formula C22H19KN4O5S and a molecular weight of 490.58 g/mol. Its IUPAC name is potassium;N-(benzenesulfonyl)-2-methyl-3-[(4-nitrophenyl)methyl]benzimidazole-5-carboxamide;hydride.
| Compound Name | potassium;N-(benzenesulfonyl)-2-methyl-3-[(4-nitrophenyl)methyl]benzimidazole-5-carboxamide;hydride |
|---|---|
| PubChem CID | 173201492 |
| Molecular Formula | C22H19KN4O5S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | potassium;N-(benzenesulfonyl)-2-methyl-3-[(4-nitrophenyl)methyl]benzimidazole-5-carboxamide;hydride |
| SMILES | Cc1nc2ccc(C(=O)NS(=O)(=O)c3ccccc3)cc2n1Cc1ccc([N+](=O)[O-])cc1.[H-].[K+] |
| InChI | InChI=1S/C22H18N4O5S.K.H/c1-15-23-20-12-9-17(22(27)24-32(30,31)19-5-3-2-4-6-19)13-21(20)25(15)14-16-7-10-18(11-8-16)26(28)29;;/h2-13H,14H2,1H3,(H,24,27);;/q;+1;-1 |
| InChIKey | BPNSTINBUSWKES-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|