C31H26ClN3O3S — CID 54153744
3-[[2-chloro-4-(2-phenylethenyl)phenyl]methyl]-2-methyl-N-(4-methylphenyl)sulfonylbenzimidazole-5-carboxamide (PubChem CID 54153744) has the molecular formula C31H26ClN3O3S and a molecular weight of 556.09 g/mol. Its IUPAC name is 3-[[2-chloro-4-(2-phenylethenyl)phenyl]methyl]-2-methyl-N-(4-methylphenyl)sulfonylbenzimidazole-5-carboxamide.
| Compound Name | 3-[[2-chloro-4-(2-phenylethenyl)phenyl]methyl]-2-methyl-N-(4-methylphenyl)sulfonylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 54153744 |
| Molecular Formula | C31H26ClN3O3S |
| Molecular Weight | 556.09 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | 3-[[2-chloro-4-(2-phenylethenyl)phenyl]methyl]-2-methyl-N-(4-methylphenyl)sulfonylbenzimidazole-5-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)c2ccc3nc(C)n(Cc4ccc(C=Cc5ccccc5)cc4Cl)c3c2)cc1 |
| InChI | InChI=1S/C31H26ClN3O3S/c1-21-8-15-27(16-9-21)39(37,38)34-31(36)25-14-17-29-30(19-25)35(22(2)33-29)20-26-13-12-24(18-28(26)32)11-10-23-6-4-3-5-7-23/h3-19H,20H2,1-2H3,(H,34,36) |
| InChIKey | OJORVCWGQDYKNI-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.09 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|