C24H22ClN3O3S — CID 18681167
N-(benzenesulfonyl)-3-[3-[(2-chlorophenyl)methyl]-2-methylbenzimidazol-5-yl]propanamide (PubChem CID 18681167) has the molecular formula C24H22ClN3O3S and a molecular weight of 467.98 g/mol. Its IUPAC name is N-(benzenesulfonyl)-3-[3-[(2-chlorophenyl)methyl]-2-methylbenzimidazol-5-yl]propanamide.
| Compound Name | N-(benzenesulfonyl)-3-[3-[(2-chlorophenyl)methyl]-2-methylbenzimidazol-5-yl]propanamide |
|---|---|
| PubChem CID | 18681167 |
| Molecular Formula | C24H22ClN3O3S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | N-(benzenesulfonyl)-3-[3-[(2-chlorophenyl)methyl]-2-methylbenzimidazol-5-yl]propanamide |
| SMILES | Cc1nc2ccc(CCC(=O)NS(=O)(=O)c3ccccc3)cc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C24H22ClN3O3S/c1-17-26-22-13-11-18(15-23(22)28(17)16-19-7-5-6-10-21(19)25)12-14-24(29)27-32(30,31)20-8-3-2-4-9-20/h2-11,13,15H,12,14,16H2,1H3,(H,27,29) |
| InChIKey | OJHYSQZNKCFVFS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |