C19H20ClN3O4S — CID 66925954
1-[(2-chlorophenyl)methyl]-6-[2-methoxyethyl(sulfino)carbamoyl]-2-methylbenzimidazole (PubChem CID 66925954) has the molecular formula C19H20ClN3O4S and a molecular weight of 421.91 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-6-[2-methoxyethyl(sulfino)carbamoyl]-2-methylbenzimidazole.
| Compound Name | 1-[(2-chlorophenyl)methyl]-6-[2-methoxyethyl(sulfino)carbamoyl]-2-methylbenzimidazole |
|---|---|
| PubChem CID | 66925954 |
| Molecular Formula | C19H20ClN3O4S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-6-[2-methoxyethyl(sulfino)carbamoyl]-2-methylbenzimidazole |
| SMILES | COCCN(C(=O)c1ccc2nc(C)n(Cc3ccccc3Cl)c2c1)S(=O)O |
| InChI | InChI=1S/C19H20ClN3O4S/c1-13-21-17-8-7-14(19(24)23(28(25)26)9-10-27-2)11-18(17)22(13)12-15-5-3-4-6-16(15)20/h3-8,11H,9-10,12H2,1-2H3,(H,25,26) |
| InChIKey | HGPZYLWBHPPIOG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|