C18H19ClN2S — CID 134083749
1-[(2-chlorophenyl)methyl]-2-methyl-6-propylsulfanylbenzimidazole (PubChem CID 134083749) has the molecular formula C18H19ClN2S and a molecular weight of 330.88 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-2-methyl-6-propylsulfanylbenzimidazole.
| Compound Name | 1-[(2-chlorophenyl)methyl]-2-methyl-6-propylsulfanylbenzimidazole |
|---|---|
| PubChem CID | 134083749 |
| Molecular Formula | C18H19ClN2S |
| Molecular Weight | 330.88 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-2-methyl-6-propylsulfanylbenzimidazole |
| SMILES | CCCSc1ccc2nc(C)n(Cc3ccccc3Cl)c2c1 |
| InChI | InChI=1S/C18H19ClN2S/c1-3-10-22-15-8-9-17-18(11-15)21(13(2)20-17)12-14-6-4-5-7-16(14)19/h4-9,11H,3,10,12H2,1-2H3 |
| InChIKey | SLLJGRUIEVCEEZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.88 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |