C22H26Cl2N2S — CID 134084050
2-(2,4-dichlorophenyl)-1-hexyl-6-propylsulfanylbenzimidazole (PubChem CID 134084050) has the molecular formula C22H26Cl2N2S and a molecular weight of 421.44 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-hexyl-6-propylsulfanylbenzimidazole.
| Compound Name | 2-(2,4-dichlorophenyl)-1-hexyl-6-propylsulfanylbenzimidazole |
|---|---|
| PubChem CID | 134084050 |
| Molecular Formula | C22H26Cl2N2S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-hexyl-6-propylsulfanylbenzimidazole |
| SMILES | CCCCCCn1c(-c2ccc(Cl)cc2Cl)nc2ccc(SCCC)cc21 |
| InChI | InChI=1S/C22H26Cl2N2S/c1-3-5-6-7-12-26-21-15-17(27-13-4-2)9-11-20(21)25-22(26)18-10-8-16(23)14-19(18)24/h8-11,14-15H,3-7,12-13H2,1-2H3 |
| InChIKey | ARACJYKSPDQDHG-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|