C19H16Cl2N4 — CID 2038367
3-butyl-2-(2,4-dichlorophenyl)imidazo[4,5-b]quinoxaline (PubChem CID 2038367) has the molecular formula C19H16Cl2N4 and a molecular weight of 371.27 g/mol. Its IUPAC name is 3-butyl-2-(2,4-dichlorophenyl)imidazo[4,5-b]quinoxaline.
| Compound Name | 3-butyl-2-(2,4-dichlorophenyl)imidazo[4,5-b]quinoxaline |
|---|---|
| PubChem CID | 2038367 |
| Molecular Formula | C19H16Cl2N4 |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 3-butyl-2-(2,4-dichlorophenyl)imidazo[4,5-b]quinoxaline |
| SMILES | CCCCn1c(-c2ccc(Cl)cc2Cl)nc2nc3ccccc3nc21 |
| InChI | InChI=1S/C19H16Cl2N4/c1-2-3-10-25-18(13-9-8-12(20)11-14(13)21)24-17-19(25)23-16-7-5-4-6-15(16)22-17/h4-9,11H,2-3,10H2,1H3 |
| InChIKey | BXQUPZLNYQGSLH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |