C21H18Cl2N4 — CID 5183651
3-cyclohexyl-2-(2,4-dichlorophenyl)imidazo[4,5-b]quinoxaline (PubChem CID 5183651) has the molecular formula C21H18Cl2N4 and a molecular weight of 397.31 g/mol. Its IUPAC name is 3-cyclohexyl-2-(2,4-dichlorophenyl)imidazo[4,5-b]quinoxaline.
| Compound Name | 3-cyclohexyl-2-(2,4-dichlorophenyl)imidazo[4,5-b]quinoxaline |
|---|---|
| PubChem CID | 5183651 |
| Molecular Formula | C21H18Cl2N4 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 3-cyclohexyl-2-(2,4-dichlorophenyl)imidazo[4,5-b]quinoxaline |
| SMILES | Clc1ccc(-c2nc3nc4ccccc4nc3n2C2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C21H18Cl2N4/c22-13-10-11-15(16(23)12-13)20-26-19-21(27(20)14-6-2-1-3-7-14)25-18-9-5-4-8-17(18)24-19/h4-5,8-12,14H,1-3,6-7H2 |
| InChIKey | NGZMDKQWKVQLIX-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |