C16H14Cl2N2O — CID 90027577
1-[(2,5-dichlorophenyl)methyl]-6-methoxy-2-methylbenzimidazole (PubChem CID 90027577) has the molecular formula C16H14Cl2N2O and a molecular weight of 321.21 g/mol. Its IUPAC name is 1-[(2,5-dichlorophenyl)methyl]-6-methoxy-2-methylbenzimidazole.
| Compound Name | 1-[(2,5-dichlorophenyl)methyl]-6-methoxy-2-methylbenzimidazole |
|---|---|
| PubChem CID | 90027577 |
| Molecular Formula | C16H14Cl2N2O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 1-[(2,5-dichlorophenyl)methyl]-6-methoxy-2-methylbenzimidazole |
| SMILES | COc1ccc2nc(C)n(Cc3cc(Cl)ccc3Cl)c2c1 |
| InChI | InChI=1S/C16H14Cl2N2O/c1-10-19-15-6-4-13(21-2)8-16(15)20(10)9-11-7-12(17)3-5-14(11)18/h3-8H,9H2,1-2H3 |
| InChIKey | REUHBNGYGOHNAX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |