About 5-[3-[(2,5-dichlorophenyl)methyl]-6-fluoro-2-methylbenzimidazol-5-yl]-1H-pyridin-2-one
5-[3-[(2,5-dichlorophenyl)methyl]-6-fluoro-2-methylbenzimidazol-5-yl]-1H-pyridin-2-one (PubChem CID 90034087) has the molecular formula C20H14Cl2FN3O
and a molecular weight of 402.26 g/mol. Its IUPAC name is 5-[3-[(2,5-dichlorophenyl)methyl]-6-fluoro-2-methylbenzimidazol-5-yl]-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-[3-[(2,5-dichlorophenyl)methyl]-6-fluoro-2-methylbenzimidazol-5-yl]-1H-pyridin-2-one |
| PubChem CID | 90034087 |
| Molecular Formula | C20H14Cl2FN3O |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 5-[3-[(2,5-dichlorophenyl)methyl]-6-fluoro-2-methylbenzimidazol-5-yl]-1H-pyridin-2-one |
| SMILES | Cc1nc2cc(F)c(-c3ccc(=O)[nH]c3)cc2n1Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H14Cl2FN3O/c1-11-25-18-8-17(23)15(12-2-5-20(27)24-9-12)7-19(18)26(11)10-13-6-14(21)3-4-16(13)22/h2-9H,10H2,1H3,(H,24,27) |
| InChIKey | QRRULWXWBRFCGY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[3-[(2,5-dichlorophenyl)methyl]-6-fluoro-2-methylbenzimidazol-5-yl]-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[(2,5-dichlorophenyl)methyl]-6-fluoro-2-methylbenzimidazol-5-yl]-1H-pyridin-2-one?
The IUPAC name of 5-[3-[(2,5-dichlorophenyl)methyl]-6-fluoro-2-methylbenzimidazol-5-yl]-1H-pyridin-2-one (CID 90034087) is 5-[3-[(2,5-dichlorophenyl)methyl]-6-fluoro-2-methylbenzimidazol-5-yl]-1H-pyridin-2-one.
What is the SMILES notation for 5-[3-[(2,5-dichlorophenyl)methyl]-6-fluoro-2-methylbenzimidazol-5-yl]-1H-pyridin-2-one?
The canonical SMILES for 5-[3-[(2,5-dichlorophenyl)methyl]-6-fluoro-2-methylbenzimidazol-5-yl]-1H-pyridin-2-one is Cc1nc2cc(F)c(-c3ccc(=O)[nH]c3)cc2n1Cc1cc(Cl)ccc1Cl.
What is the InChIKey of 5-[3-[(2,5-dichlorophenyl)methyl]-6-fluoro-2-methylbenzimidazol-5-yl]-1H-pyridin-2-one?
The InChIKey is QRRULWXWBRFCGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14Cl2FN3O/c1-11-25-18-8-17(23)15(12-2-5-20(27)24-9-12)7-19(18)26(11)10-13-6-14(21)3-4-16(13)22/h2-9H,10H2,1H3,(H,24,27).
What are the key properties of 5-[3-[(2,5-dichlorophenyl)methyl]-6-fluoro-2-methylbenzimidazol-5-yl]-1H-pyridin-2-one?
5-[3-[(2,5-dichlorophenyl)methyl]-6-fluoro-2-methylbenzimidazol-5-yl]-1H-pyridin-2-one has a molecular weight of 402.26 g/mol, XLogP of 5.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[(2,5-dichlorophenyl)methyl]-6-fluoro-2-methylbenzimidazol-5-yl]-1H-pyridin-2-one is sourced from PubChem (CID 90034087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).