C20H22ClN3O — CID 66670689
1-[(4-chlorophenyl)methyl]-6-methoxy-2-(pyrrolidin-1-ylmethyl)benzimidazole (PubChem CID 66670689) has the molecular formula C20H22ClN3O and a molecular weight of 355.87 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-6-methoxy-2-(pyrrolidin-1-ylmethyl)benzimidazole.
| Compound Name | 1-[(4-chlorophenyl)methyl]-6-methoxy-2-(pyrrolidin-1-ylmethyl)benzimidazole |
|---|---|
| PubChem CID | 66670689 |
| Molecular Formula | C20H22ClN3O |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-6-methoxy-2-(pyrrolidin-1-ylmethyl)benzimidazole |
| SMILES | COc1ccc2nc(CN3CCCC3)n(Cc3ccc(Cl)cc3)c2c1 |
| InChI | InChI=1S/C20H22ClN3O/c1-25-17-8-9-18-19(12-17)24(13-15-4-6-16(21)7-5-15)20(22-18)14-23-10-2-3-11-23/h4-9,12H,2-3,10-11,13-14H2,1H3 |
| InChIKey | IZQSUECDESDKJE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |