C23H29N3 — CID 18884998
1-[(4-tert-butylphenyl)methyl]-2-(pyrrolidin-1-ylmethyl)benzimidazole (PubChem CID 18884998) has the molecular formula C23H29N3 and a molecular weight of 347.51 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-2-(pyrrolidin-1-ylmethyl)benzimidazole.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-2-(pyrrolidin-1-ylmethyl)benzimidazole |
|---|---|
| PubChem CID | 18884998 |
| Molecular Formula | C23H29N3 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-2-(pyrrolidin-1-ylmethyl)benzimidazole |
| SMILES | CC(C)(C)c1ccc(Cn2c(CN3CCCC3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C23H29N3/c1-23(2,3)19-12-10-18(11-13-19)16-26-21-9-5-4-8-20(21)24-22(26)17-25-14-6-7-15-25/h4-5,8-13H,6-7,14-17H2,1-3H3 |
| InChIKey | QEPULILMPRFRBX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |