C26H36N4 — CID 18885452
1-[(4-tert-butylphenyl)methyl]-2-[3-(4-methylpiperazin-1-yl)propyl]benzimidazole (PubChem CID 18885452) has the molecular formula C26H36N4 and a molecular weight of 404.60 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-2-[3-(4-methylpiperazin-1-yl)propyl]benzimidazole.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-2-[3-(4-methylpiperazin-1-yl)propyl]benzimidazole |
|---|---|
| PubChem CID | 18885452 |
| Molecular Formula | C26H36N4 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-2-[3-(4-methylpiperazin-1-yl)propyl]benzimidazole |
| SMILES | CN1CCN(CCCc2nc3ccccc3n2Cc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C26H36N4/c1-26(2,3)22-13-11-21(12-14-22)20-30-24-9-6-5-8-23(24)27-25(30)10-7-15-29-18-16-28(4)17-19-29/h5-6,8-9,11-14H,7,10,15-20H2,1-4H3 |
| InChIKey | FDFFCAWATFPKBV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |