C19H21ClIN3 — CID 134350366
1-[(4-chlorophenyl)methyl]-2-(pyrrolidin-1-ylmethyl)benzimidazole;hydroiodide (PubChem CID 134350366) has the molecular formula C19H21ClIN3 and a molecular weight of 453.76 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-2-(pyrrolidin-1-ylmethyl)benzimidazole;hydroiodide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-2-(pyrrolidin-1-ylmethyl)benzimidazole;hydroiodide |
|---|---|
| PubChem CID | 134350366 |
| Molecular Formula | C19H21ClIN3 |
| Molecular Weight | 453.76 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2-(pyrrolidin-1-ylmethyl)benzimidazole;hydroiodide |
| SMILES | Clc1ccc(Cn2c(CN3CCCC3)nc3ccccc32)cc1.I |
| InChI | InChI=1S/C19H20ClN3.HI/c20-16-9-7-15(8-10-16)13-23-18-6-2-1-5-17(18)21-19(23)14-22-11-3-4-12-22;/h1-2,5-10H,3-4,11-14H2;1H |
| InChIKey | MUDJZDXRPLWBNB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.76 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|